Loading distributor info...
| Description | Matrine((+)-Matrine) is an alkaloid found in plants from the Sophora family. It has a variety of pharmacological effects, including anti-cancer effects, and action as a kappa opioid receptor agonist. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10559 |
|---|---|
| Formula | C15H24N2O |
| Molecular Weight | 248.36 |
| CAS Number | 519-02-8 |
| SMILES | C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@@H](CCC4)CN2C(=O)C1 |
| Synonyms | (+)-Matrine, Matridin-15-one |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (189.24 mM) | |
| Water | Warmed: 11 mg/mL (44.29 mM) | ||
| Ethanol | 47 mg/mL (189.24 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.26 mL | 201.32 mL | 402.64 mL |
| 0.5 mM | 8.05 mL | 40.26 mL | 80.53 mL |
| 1 mM | 4.03 mL | 20.13 mL | 40.26 mL |
| 5 mM | 0.81 mL | 4.03 mL | 8.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
