Loading distributor info...
| Description | Occupies mortalin-2 (mot-2), a member of the Hsp70 family, at its p53 binding site and enables p53 translocation to the nucleus. Selectively cytotoxic; causes growth arrest of cancer cells in culture. Also inhibits telomerase activity and cross-links F-actin. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12388 |
|---|---|
| Formula | C21H22ClN3OS2 |
| Molecular Weight | 432 |
| CAS Number | 147366-41-4 |
| SMILES | CCN1/C(=C/C2=CC=CC=[N+]2CC)/S/C(=C/3\N(C4=CC=CC=C4S3)C)/C1=O.[Cl-] |
| Synonyms | MKT077, MKT-077 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 11 mg/mL (25.46 mM) | |
| Water | 75 mg/mL (173.61 mM) | ||
| Ethanol | 9 mg/mL (20.83 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.15 mL | 115.74 mL | 231.48 mL |
| 0.5 mM | 4.63 mL | 23.15 mL | 46.3 mL |
| 1 mM | 2.31 mL | 11.57 mL | 23.15 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
