Loading distributor info...
| Description | MPTP hydrochloride induced reduction in the DOPAC HVA/dopamine (DA) ratio and increase in striatal ascorbate (AS) oxidation in rats. |
|---|
| Catalog Num | A15173 |
|---|---|
| Formula | C12H15N.HCl |
| Molecular Weight | 209.71 |
| CAS Number | 23007-85-4 |
| SMILES | CN1CCC(=CC1)C2=CC=CC=C2.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (81.06 mM) | |
| Water | 36 mg/mL (171.65 mM) | ||
| Ethanol | 36 mg/mL (171.65 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.68 mL | 238.42 mL | 476.85 mL |
| 0.5 mM | 9.54 mL | 47.68 mL | 95.37 mL |
| 1 mM | 4.77 mL | 23.84 mL | 47.68 mL |
| 5 mM | 0.95 mL | 4.77 mL | 9.54 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
