Loading distributor info...
| Description | NXY-059 is the disulfonyl derivative of the neuroprotective spin trap pheny lbutynitrone or "PBN" with free radical-trapping properties. It substantially lessens the functional disability resulting from cerebral ischemia in a primate species. |
|---|
| Catalog Num | A10663 |
|---|---|
| Formula | C11H13NNa2O7S2 |
| Molecular Weight | 381.3 |
| CAS Number | 168021-79-2 |
| SMILES | CC(C)(C)/[N+](=C/C1=C(C=C(C=C1)S(=O)(=O)[O-])S(=O)(=O)[O-])/[O-].[Na+].[Na+] |
| Synonyms | Disufenton sodium |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 71 mg/mL (186.19 mM) | |
| Water | 71 mg/mL (186.19 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.23 mL | 131.13 mL | 262.26 mL |
| 0.5 mM | 5.25 mL | 26.23 mL | 52.45 mL |
| 1 mM | 2.62 mL | 13.11 mL | 26.23 mL |
| 5 mM | 0.52 mL | 2.62 mL | 5.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
