Loading distributor info...
| Description | OG-L002 is a potent and specific LSD1 inhibitor with IC50 of 20 nM, exhibiting 36- and 69-fold selectivity over MAO-B and MAO-A, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13246 |
|---|---|
| Formula | C15H15NO |
| Molecular Weight | 225.28 |
| CAS Number | 1357302-64-7 |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=C(C=C2)C3=CC(=CC=C3)O |
| Synonyms | OGL002, OG L002 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 41 mg/mL (181.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (75.45 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 19 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.39 mL | 221.95 mL | 443.89 mL |
| 0.5 mM | 8.88 mL | 44.39 mL | 88.78 mL |
| 1 mM | 4.44 mL | 22.19 mL | 44.39 mL |
| 5 mM | 0.89 mL | 4.44 mL | 8.88 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
