Org 27569
Catalog No.: A11513
CB1 modulator?€?
Org 27569 is a potent CB1 receptor allosteric modulator (pEC50 = 8.24).
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Org 27569 is a potent CB1 receptor allosteric modulator (pEC50 = 8.24). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11513 |
|---|---|
| Formula | C24H28ClN3O |
| Molecular Weight | 409.95 |
| CAS Number | 868273-06-7 |
| SMILES | CCC1=C(NC2=C1C=C(C=C2)Cl)C(=O)NCCC3=CC=C(C=C3)N4CCCCC4 |
| Synonyms | Org27569, Org-27569 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (173.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.39 mL | 121.97 mL | 243.93 mL |
| 0.5 mM | 4.88 mL | 24.39 mL | 48.79 mL |
| 1 mM | 2.44 mL | 12.2 mL | 24.39 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.88 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2