Oroxin B
Catalog No.: A14696
Oroxin B, extracted from Oroxylum indicum.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Oroxin B, extracted from Oroxylum indicum. |
|---|
| Catalog Num | A14696 |
|---|---|
| Formula | C27H30O15 |
| Molecular Weight | 594.52 |
| CAS Number | 114482-86-9 |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O |
| Synonyms | Baicalein 7-O-beta-gentiobioside, Baicalein 7-O-diglucoside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (142.97 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.82 mL | 84.1 mL | 168.2 mL |
| 0.5 mM | 3.36 mL | 16.82 mL | 33.64 mL |
| 1 mM | 1.68 mL | 8.41 mL | 16.82 mL |
| 5 mM | 0.34 mL | 1.68 mL | 3.36 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2