Loading distributor info...
| Description | ORY-1001 is an orally active and selective lysine-specific demethylase LSD1/KDM1A inhibitor with IC50 of <20 nM, with high selectivity against related FAD dependent aminoxidases. Phase 1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15893 |
|---|---|
| Formula | C15H22N2.2HCl |
| Molecular Weight | 303.27 |
| CAS Number | 1431326-61-2 |
| SMILES | NC1CCC(N[C@@H]2C[C@H]2C3=CC=CC=C3)CC1.Cl.Cl |
| Synonyms | RG6016, RG-6016 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (13.18 mM) | |
| Water | 53 mg/mL (174.76 mM) | ||
| Ethanol | Warmed: 3 mg/mL (9.89 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.97 mL | 164.87 mL | 329.74 mL |
| 0.5 mM | 6.59 mL | 32.97 mL | 65.95 mL |
| 1 mM | 3.3 mL | 16.49 mL | 32.97 mL |
| 5 mM | 0.66 mL | 3.3 mL | 6.59 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
