Loading distributor info...
| Description | PF-06447475 is a highly potent, selective, brain penetrant LRRK2 inhibitor with IC50 of 3 nM/11 nM for Wt LRRK2/G2019S LRRK2 respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15504 |
|---|---|
| Formula | C17H15N5O |
| Molecular Weight | 305.33 |
| CAS Number | 1527473-33-1 |
| SMILES | C1COCCN1C2=NC=NC3=C2C(=CN3)C4=CC=CC(=C4)C#N |
| Synonyms | PF06447475, PF 06447475 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (183.4 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.76 mL | 327.51 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.5 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.75 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
