PF-2545920
PF-2545920 is a phosphodiesterase inhibitor selective for the PDE10A subtype.
Loading distributor info...
PF-2545920 is a phosphodiesterase inhibitor selective for the PDE10A subtype.
Loading distributor info...
| Description | PF-2545920 is a phosphodiesterase inhibitor selective for the PDE10A subtype. |
|---|
| Catalog Num | A11191 |
|---|---|
| Formula | C25H20N4O |
| Molecular Weight | 392.45 |
| CAS Number | 1292799-56-4 |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)OCC3=NC4=CC=CC=C4C=C3)C5=CC=NC=C5 |
| Synonyms | PF2545920 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 66 mg/mL (168.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 66 mg/mL (168.17 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.48 mL | 127.4 mL | 254.81 mL |
| 0.5 mM | 5.1 mL | 25.48 mL | 50.96 mL |
| 1 mM | 2.55 mL | 12.74 mL | 25.48 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.1 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2