Loading distributor info...
| Description | Phenylephrine is a selective α1-adrenergic receptor agonist used primarily as a decongestant, as an agent to dilate the pupil, and to increase blood pressure. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11666 |
|---|---|
| Formula | C9H13NO2.HCl |
| Molecular Weight | 203.67 |
| CAS Number | 61-76-7 |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
| Synonyms | L(-)-Phenylephrine hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (171.84 mM) | |
| Water | 35 mg/mL (171.84 mM) | ||
| Ethanol | 35 mg/mL (171.84 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.1 mL | 245.5 mL | 490.99 mL |
| 0.5 mM | 9.82 mL | 49.1 mL | 98.2 mL |
| 1 mM | 4.91 mL | 24.55 mL | 49.1 mL |
| 5 mM | 0.98 mL | 4.91 mL | 9.82 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
