Loading distributor info...
| Description | Pimobendan (Vetmedin) is a calcium sensitizer with positive inotropic and vasodilator effects. It is also a selective inhibitor of phosphodiesterase III (PDE3). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10733 |
|---|---|
| Formula | C19H18N4O2 |
| Molecular Weight | 334.4 |
| CAS Number | 74150-27-9 |
| SMILES | CC1CC(=O)NN=C1C2=CC3=C(C=C2)N=C(N3)C4=CC=C(C=C4)OC |
| Synonyms | Acardi, pimobendane |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (185.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (14.95 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.9 mL | 149.52 mL | 299.04 mL |
| 0.5 mM | 5.98 mL | 29.9 mL | 59.81 mL |
| 1 mM | 2.99 mL | 14.95 mL | 29.9 mL |
| 5 mM | 0.6 mL | 2.99 mL | 5.98 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
