pirinixic acid (WY 14643)
Catalog No.: A12360
PPARα agonist
WY 14643 is a highly potent PPARα agonist.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | WY 14643 is a highly potent PPARα agonist. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12360 |
|---|---|
| Formula | C14H14ClN3O2S |
| Molecular Weight | 323.8 |
| CAS Number | 50892-23-4 |
| SMILES | CC1=C(C(=CC=C1)NC2=CC(=NC(=N2)SCC(=O)O)Cl)C |
| Synonyms | WY 14643 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 63 mg/mL (194.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL (157.5 mM) | ||
| In vivo | 30% PEG400+2% Tween 80+PBS | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.88 mL | 154.42 mL | 308.83 mL |
| 0.5 mM | 6.18 mL | 30.88 mL | 61.77 mL |
| 1 mM | 3.09 mL | 15.44 mL | 30.88 mL |
| 5 mM | 0.62 mL | 3.09 mL | 6.18 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2