Loading distributor info...
| Description | PLX7904 is a potent and selective paradox-breaker RAF inhibitor. It is able to efficiently inhibit activation of ERK1/2 in mutant BRAF melanoma cells but does not hyperactivate ERK1/2 in mutant RAS-expressing cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15855 |
|---|---|
| Formula | C24H22F2N6O3S |
| Molecular Weight | 512.53 |
| CAS Number | 1393465-84-3 |
| SMILES | O=C(C1=CNC2=NC=C(C3=CN=C(C4CC4)N=C3)C=C21)C5=C(F)C=CC(NS(=O)(N(CC)C)=O)=C5F |
| Synonyms | PB04 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (169.75 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.51 mL | 97.56 mL | 195.11 mL |
| 0.5 mM | 3.9 mL | 19.51 mL | 39.02 mL |
| 1 mM | 1.95 mL | 9.76 mL | 19.51 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.9 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
