Loading distributor info...
| Description | Rimantadine is an orally administered antiviral drug used to treat, and in rare cases prevent, influenzavirus A infection. Rimantadine is believed to inhibit influenza's viral replication, possibly by preventing the uncoating of the virus's protective shells, which are the envelope and capsid. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11661 |
|---|---|
| Formula | C12H21N |
| Molecular Weight | 179.3 |
| CAS Number | 13392-28-4 |
| SMILES | CC(C12CC3CC(C1)CC(C3)C2)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (167.31 mM) | |
| Water | 30 mg/mL (167.31 mM) | ||
| Ethanol | 30 mg/mL (167.31 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 55.77 mL | 278.86 mL | 557.72 mL |
| 0.5 mM | 11.15 mL | 55.77 mL | 111.54 mL |
| 1 mM | 5.58 mL | 27.89 mL | 55.77 mL |
| 5 mM | 1.12 mL | 5.58 mL | 11.15 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
