Roflumilast
Roflumilast acts as a selective, long-acting inhibitor of the enzyme PDE-4.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Roflumilast acts as a selective, long-acting inhibitor of the enzyme PDE-4. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10804 |
|---|---|
| Formula | C17H14Cl2F2N2O3 |
| Molecular Weight | 403.2 |
| CAS Number | 162401-32-3 |
| SMILES | C1CC1COC2=C(C=CC(=C2)C(=O)NC3=C(C=NC=C3Cl)Cl)OC(F)F |
| Synonyms | Daxas, Daliresp |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 70 mg/mL (173.6 mM) | |
| Water | Insoluble | ||
| Ethanol | 13 mg/mL (32.24 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.8 mL | 124.01 mL | 248.02 mL |
| 0.5 mM | 4.96 mL | 24.8 mL | 49.6 mL |
| 1 mM | 2.48 mL | 12.4 mL | 24.8 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.96 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2