RS-127445 is a potent and selective antagonist at the serotonin 5-HT2B receptor, with around 1000x selectivity over the closely related 5-HT2A and 5-HT2C receptors.
Loading distributor info...
| Description | RS-127445 is a potent and selective antagonist at the serotonin 5-HT2B receptor, with around 1000x selectivity over the closely related 5-HT2A and 5-HT2C receptors. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11165 |
|---|---|
| Formula | C17H16FN3 |
| Molecular Weight | 281.33 |
| CAS Number | 199864-87-4 |
| SMILES | CC(C)C1=NC(=NC(=C1)C2=CC=C(C3=CC=CC=C32)F)N |
| Synonyms | RS127445, MT 500, RS127,445 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (191.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (28.43 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.55 mL | 177.73 mL | 355.45 mL |
| 0.5 mM | 7.11 mL | 35.55 mL | 71.09 mL |
| 1 mM | 3.55 mL | 17.77 mL | 35.55 mL |
| 5 mM | 0.71 mL | 3.55 mL | 7.11 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
