Loading distributor info...
| Description | Scoparone is a compound found in the herb, Yin Chin, that can up-regulate the expression and activate the CAR (constitutive androstane receptor) found in the liver. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14856 |
|---|---|
| Formula | C11H10O4 |
| Molecular Weight | 206.19 |
| CAS Number | 120-08-1 |
| SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (179.44 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL (179.44 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.5 mL | 242.49 mL | 484.99 mL |
| 0.5 mM | 9.7 mL | 48.5 mL | 97 mL |
| 1 mM | 4.85 mL | 24.25 mL | 48.5 mL |
| 5 mM | 0.97 mL | 4.85 mL | 9.7 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
