Loading distributor info...
| Description | SIB 1757 is a highly selective antagonist for the mGlu5 metabotropic glutamate receptor subtype. |
|---|
| Catalog Num | A13758 |
|---|---|
| Formula | C12H11N3O |
| Molecular Weight | 213.24 |
| CAS Number | 31993-01-8 |
| SMILES | CC1=N/C(=N\NC2=CC=CC=C2)/C(=O)C=C1 |
| Synonyms | SIB-1757, SIB1757 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 22 mg/mL (103.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (42.2 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.9 mL | 234.48 mL | 468.96 mL |
| 0.5 mM | 9.38 mL | 46.9 mL | 93.79 mL |
| 1 mM | 4.69 mL | 23.45 mL | 46.9 mL |
| 5 mM | 0.94 mL | 4.69 mL | 9.38 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
