Loading distributor info...
| Description | Spectinomycin is an antibiotic useful for the treatment of the bacterial infection, gonorrhea. |
|---|
| Catalog Num | A10861 |
|---|---|
| Formula | C14H26Cl2N2O7 |
| Molecular Weight | 405.27 |
| CAS Number | 21736-83-4 |
| SMILES | C[C@@H]1CC(=O)[C@]2([C@@H](O1)O[C@@H]3[C@H]([C@@H]([C@@H]([C@@H]([C@H]3O2)NC)O)NC)O)O.Cl.Cl |
| Synonyms | NSC 248616 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 74 mg/mL (182.59 mM) | |
| Water | 74 mg/mL (182.59 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.67 mL | 123.37 mL | 246.75 mL |
| 0.5 mM | 4.93 mL | 24.67 mL | 49.35 mL |
| 1 mM | 2.47 mL | 12.34 mL | 24.67 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.93 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
