Loading distributor info...
| Description | Stattic is a small molecule shown to selectively inhibit the activation of the Stat3 transcription factor by blocking phosphorylation and dimerization events. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12733 |
|---|---|
| Formula | C8H5NO4S |
| Molecular Weight | 211.19 |
| CAS Number | 19983-44-9 |
| SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)[N+](=O)[O-] |
| Synonyms | STAT3 Inhibitor V |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 38 mg/mL (179.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40% PEG 300+5% Tween 80+50% ddH2O | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.35 mL | 236.75 mL | 473.51 mL |
| 0.5 mM | 9.47 mL | 47.35 mL | 94.7 mL |
| 1 mM | 4.74 mL | 23.68 mL | 47.35 mL |
| 5 mM | 0.95 mL | 4.74 mL | 9.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
