Loading distributor info...
| Description | T0070907 was identified as a potent and selective PPARgamma antagonist. With an apparent binding affinity (concentration at 50% inhibition of [(3)H]rosiglitazone binding or IC(50)) of 1 nm, T0070907 covalently modifies PPARgamma on cysteine 313 in helix 3 of human PPARgamma2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11588 |
|---|---|
| Formula | C12H8ClN3O3 |
| Molecular Weight | 277.66 |
| CAS Number | 313516-66-4 |
| SMILES | ClC1=CC=C([N+]([O-])=O)C=C1C(NC2=CC=NC=C2)=O |
| Synonyms | T 0070907 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 24 mg/mL (86.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 8 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.02 mL | 180.08 mL | 360.15 mL |
| 0.5 mM | 7.2 mL | 36.02 mL | 72.03 mL |
| 1 mM | 3.6 mL | 18.01 mL | 36.02 mL |
| 5 mM | 0.72 mL | 3.6 mL | 7.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
