Loading distributor info...
| Description | UK-383367 is a procollagen C-proteinase inhibitor with IC50 of 44 nM, has excellent selectivity over MMPs. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10959 |
|---|---|
| Formula | C15H24N4O4 |
| Molecular Weight | 324.4 |
| CAS Number | 348622-88-8 |
| SMILES | C1CCC(CC1)CCC[C@H](CC(=O)NO)C2=NC(=NO2)C(=O)N |
| Synonyms | UK383367 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 56 mg/mL (172.64 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (172.64 mM) | ||
| In vivo | 15% Captisol | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.83 mL | 154.13 mL | 308.26 mL |
| 0.5 mM | 6.17 mL | 30.83 mL | 61.65 mL |
| 1 mM | 3.08 mL | 15.41 mL | 30.83 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
