Loading distributor info...
| Description | UNC0642 is a potent and selective G9a and GLP histone lysine methyltransferase inhibitor (IC50 < 2.5 nM). It reduces H3K9 dimethylation levels in MDA-MB-231 cells (IC50 = 110 nM). Displays modest brain penetration in vivo. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15487 |
|---|---|
| Formula | C29H44F2N6O2 |
| Molecular Weight | 546.69 |
| CAS Number | 1481677-78-4 |
| SMILES | CC(C)N1CCC(CC1)NC2=NC(=NC3=CC(=C(C=C32)OC)OCCCN4CCCC4)N5CCC(CC5)(F)F |
| Synonyms | UNC 0642, UNC-0642 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (160.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 88 mg/mL (160.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.29 mL | 91.46 mL | 182.92 mL |
| 0.5 mM | 3.66 mL | 18.29 mL | 36.58 mL |
| 1 mM | 1.83 mL | 9.15 mL | 18.29 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
