Loading distributor info...
| Description | UNC0646 is a potent and selective inhibitor of the homologous protein lysine methyltransferases, G9a and GLP (IC50 values are 6 nM and 15 nM for G9a and GLP, respectively). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13194 |
|---|---|
| Formula | C36H59N7O2 |
| Molecular Weight | 621.9 |
| CAS Number | 1320288-17-2 |
| SMILES | CC(C)N1CCCN(CC1)C2=NC3=CC(=C(C=C3C(=N2)NC4CCN(CC4)C5CCCCC5)OC)OCCCN6CCCCC6 |
| Synonyms | UNC 0646, UNC-0646 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 31 mg/mL (49.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.08 mL | 80.4 mL | 160.8 mL |
| 0.5 mM | 3.22 mL | 16.08 mL | 32.16 mL |
| 1 mM | 1.61 mL | 8.04 mL | 16.08 mL |
| 5 mM | 0.32 mL | 1.61 mL | 3.22 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
