Loading distributor info...
| Description | Zerumbone is a natural monocyclic sesquiterpene first isolated from rhizomes of the wild ginger Z. zerumbet.1 It potently inhibits the activation of Epstein-Barr virus by phorbol esters (IC50 = 140 nM). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13703 |
|---|---|
| Formula | C15H22O |
| Molecular Weight | 218.3 |
| CAS Number | 471-05-6 |
| SMILES | C/C/1=C\CC(/C=C/C(=O)/C(=C/CC1)/C)(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (196.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 43 mg/mL (196.94 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.81 mL | 229.04 mL | 458.09 mL |
| 0.5 mM | 9.16 mL | 45.81 mL | 91.62 mL |
| 1 mM | 4.58 mL | 22.9 mL | 45.81 mL |
| 5 mM | 0.92 mL | 4.58 mL | 9.16 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
