Loading distributor info...
| Description | ZLN005 is a PGC-1α Transcriptional Regulator, which shoed some beneficialfEffects on diabetic db/db mice. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13734 |
|---|---|
| Formula | C17H18N2 |
| Molecular Weight | 250.34 |
| CAS Number | 49671-76-3 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
| Synonyms | ZLM-005, ZLN 005 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 36 mg/mL (143.8 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (7.98 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.95 mL | 199.73 mL | 399.46 mL |
| 0.5 mM | 7.99 mL | 39.95 mL | 79.89 mL |
| 1 mM | 3.99 mL | 19.97 mL | 39.95 mL |
| 5 mM | 0.8 mL | 3.99 mL | 7.99 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
