Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ABT-702 dihydrochloride is a potent adenosine kinase (AK) inhibitor (IC50=1.7 nM). |
|---|
| Catalog Num | A19624 |
|---|---|
| Formula | C22H21BrCl2N6O |
| Molecular Weight | 536.25 |
| CAS Number | 1188890-28-9 |
| SMILES | NC1=C(C(C2=CC=CC(Br)=C2)=CC(C3=CC=C(N4CCOCC4)N=C3)=N5)C5=NC=N1.[H]Cl.[H]Cl |
| Synonyms | ABT 702, ABT702 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (167.83 mM) | |
| Water | 3 mg/mL (5.59 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.65 mL | 93.24 mL | 186.48 mL |
| 0.5 mM | 3.73 mL | 18.65 mL | 37.3 mL |
| 1 mM | 1.86 mL | 9.32 mL | 18.65 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
