Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ACP-196 is an orally available inhibitor of Bruton?€?s tyrosine kinase (BTK) with potential antineoplastic activity. It inhibits the activity of BTK and prevents the activation of the B-cell antigen receptor (BCR) signaling pathway. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15824 |
|---|---|
| Formula | C26H23N7O2 |
| Molecular Weight | 465.52 |
| CAS Number | 1420477-60-6 |
| SMILES | CC#CC(=O)N1CCCC1C2=NC(=C3N2C=CN=C3N)C4=CC=C(C=C4)C(=O)NC5=CC=CC=N5 |
| Synonyms | Acalabrutinib, ACP196, ACP 196 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 80 mg/mL (171.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 80 mg/mL (171.85 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.48 mL | 107.41 mL | 214.81 mL |
| 0.5 mM | 4.3 mL | 21.48 mL | 42.96 mL |
| 1 mM | 2.15 mL | 10.74 mL | 21.48 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
