Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | AIM-100 is a small molecule inhibitor of Ack1 with an IC50 of 24 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14986 |
|---|---|
| Formula | C23H21N3O2 |
| Molecular Weight | 371.43 |
| CAS Number | 873305-35-2 |
| SMILES | C1CC(OC1)CNC2=C3C(=C(OC3=NC=N2)C4=CC=CC=C4)C5=CC=CC=C5 |
| Synonyms | AIM 100, AIM100 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (193.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 72 mg/mL (193.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.92 mL | 134.61 mL | 269.23 mL |
| 0.5 mM | 5.38 mL | 26.92 mL | 53.85 mL |
| 1 mM | 2.69 mL | 13.46 mL | 26.92 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
