Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Altiratinib is a novel c-MET/TIE-2/VEGFR inhibitor; effectively reduce tumor burden in vivo and block c-MET pTyr(1349)-mediated signaling, cell growth and migration as compared with a HGF antagonist in vitro. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14387 |
|---|---|
| Formula | C26H21F3N4O4 |
| Molecular Weight | 510.46 |
| CAS Number | 1345847-93-9 |
| SMILES | FC1=CC=C(NC(C2(C(NC3=C(F)C=C(OC4=CC(/N=C(O)/C5CC5)=NC=C4)C(F)=C3)=O)CC2)=O)C=C1 |
| Synonyms | DCC-2701, DCC2701, DCC 2701, DP 5164, DP5164, DP-5164 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (193.94 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.59 mL | 97.95 mL | 195.9 mL |
| 0.5 mM | 3.92 mL | 19.59 mL | 39.18 mL |
| 1 mM | 1.96 mL | 9.8 mL | 19.59 mL |
| 5 mM | 0.39 mL | 1.96 mL | 3.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
