Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Anetholtrithion is a choleretic used to allay dry mouth and constipation due to tranquilizers. |
|---|
| Catalog Num | A18164 |
|---|---|
| Formula | C10H8OS3 |
| Molecular Weight | 240.35 |
| CAS Number | 532-11-6 |
| SMILES | S=C1SSC(C2=CC=C(OC)C=C2)=C1 |
| Synonyms | Anetholtrithion; Anethole trithione |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (187.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (12.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.61 mL | 208.03 mL | 416.06 mL |
| 0.5 mM | 8.32 mL | 41.61 mL | 83.21 mL |
| 1 mM | 4.16 mL | 20.8 mL | 41.61 mL |
| 5 mM | 0.83 mL | 4.16 mL | 8.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
