Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Anlotinib, also known as AL3818, is a receptor tyrosine kinase (RTK) inhibitor with potential antineoplastic and anti-angiogenic activities. CAS: 1058156-90-3 (free base) 1360460-82-7 (HCl) |
|---|
| Catalog Num | A17076 |
|---|---|
| Formula | C23H24Cl2FN3O3 |
| Molecular Weight | 480.36 |
| CAS Number | 1360460-82-7 |
| SMILES | NC1(COC2=C(OC)C=C3C(OC4=C(F)C5=C(NC(C)=C5)C=C4)=CC=NC3=C2)CC1.[H]Cl.[H]Cl |
| Synonyms | AL3818, AL-3818, AL 3818, Anlotinib; Anlotinib HCl, Anlotinib dihydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (191.52 mM) | |
| Water | 92 mg/mL (191.52 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.82 mL | 104.09 mL | 208.18 mL |
| 0.5 mM | 4.16 mL | 20.82 mL | 41.64 mL |
| 1 mM | 2.08 mL | 10.41 mL | 20.82 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
