Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ARQ 531 is a reversible non-covalent inhibitor of Bruton??s Tyrosine Kinase (BTK), with IC50s of 0.85 nM and 0.39 nM for WT-BTK and C481S-BTK, respectively. |
|---|
| Catalog Num | A19823 |
|---|---|
| Formula | C25H23ClN4O4 |
| Molecular Weight | 478.93 |
| CAS Number | 2095393-15-8 |
| SMILES | O=C(C1=C(C=C(OC2=CC=CC=C2)C=C1)Cl)C3=CNC4=NC=NC(N[C@@H]5CC[C@@H](CO)OC5)=C34 |
| Synonyms | ARQ-531, ARQ531 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (179.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (12.52 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.88 mL | 104.4 mL | 208.8 mL |
| 0.5 mM | 4.18 mL | 20.88 mL | 41.76 mL |
| 1 mM | 2.09 mL | 10.44 mL | 20.88 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
