Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ASP3026 is a novel and selective inhibitor for the ALK kinase. ASP3026 potently inhibited ALK kinase activity and was more selective than crizotinib in a Tyr-kinase panel. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11773 |
|---|---|
| Formula | C29H40N8O3S |
| Molecular Weight | 580.7 |
| CAS Number | 1097917-15-1 |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1NC2=NC=NC(=N2)NC3=C(C=C(C=C3)N4CCC(CC4)N5CCN(CC5)C)OC |
| Synonyms | ASP 3026, ASP-3026 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 13 mg/mL (22.38 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.22 mL | 86.1 mL | 172.21 mL |
| 0.5 mM | 3.44 mL | 17.22 mL | 34.44 mL |
| 1 mM | 1.72 mL | 8.61 mL | 17.22 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
