Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD4547 is a potent, selective and orally active pan-FGFR inhibitor, with IC50s of 0.2, 2.5, 1.8 and 165 nM for FGFR1, 2, 3 and 4, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11075 |
|---|---|
| Formula | C26H33N5O3 |
| Molecular Weight | 463.6 |
| CAS Number | 1035270-39-3 |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=CC=C(C=C2)C(=O)NC3=NNC(=C3)CCC4=CC(=CC(=C4)OC)OC |
| Synonyms | AZD-4547 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 79 mg/mL (170.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.57 mL | 107.85 mL | 215.7 mL |
| 0.5 mM | 4.31 mL | 21.57 mL | 43.14 mL |
| 1 mM | 2.16 mL | 10.79 mL | 21.57 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
