Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BH3I-1 is a cell permeable BH3 mimetic that binds to Bcl-xL | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16061 |
|---|---|
| Formula | C15H14BrNO3S2 |
| Molecular Weight | 400.3 |
| CAS Number | 300817-68-9 |
| SMILES | BrC1=CC=C(/C=C2C(N(C(C(O)=O)C(C)C)C(S\2)=S)=O)C=C1 |
| Synonyms | BH3I1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 56 mg/mL (139.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 11 mg/mL (27.47 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.98 mL | 124.91 mL | 249.81 mL |
| 0.5 mM | 5 mL | 24.98 mL | 49.96 mL |
| 1 mM | 2.5 mL | 12.49 mL | 24.98 mL |
| 5 mM | 0.5 mL | 2.5 mL | 5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
