Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BLU9931 is the first selective small molecule inhibitor of FGFR4 with IC50 of 3 nM; less potent for FGFR1/2/3(IC50> 150 nM), | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15534 |
|---|---|
| Formula | C26H22Cl2N4O3 |
| Molecular Weight | 509.38 |
| CAS Number | 1538604-68-0 |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C=C)NC2=NC=C3C=C(C=CC3=N2)C4=C(C(=CC(=C4Cl)OC)OC)Cl |
| Synonyms | BLU-9931, BLU 9931 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 4 mg/mL (7.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% carboxymethylcellulose+1% Tween 80 as a suspension | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.63 mL | 98.16 mL | 196.32 mL |
| 0.5 mM | 3.93 mL | 19.63 mL | 39.26 mL |
| 1 mM | 1.96 mL | 9.82 mL | 19.63 mL |
| 5 mM | 0.39 mL | 1.96 mL | 3.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
