Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bozitinib (PLB-1001) is a highly selective c-MET kinase inhibitor with blood-brain barrier permeability. Bozitinib (PLB-1001) is a ATP-competitive small-molecule inhibitor, binds to the conventional ATP-binding pocket of the tyrosine kinase superfamily. |
|---|
| Catalog Num | A18554 |
|---|---|
| Formula | C20H15F3N8 |
| Molecular Weight | 424.38 |
| CAS Number | 1440964-89-5 |
| SMILES | CN1N=C2C=C(F)C(C(C3=NN=C4C=CC(C5=CN(C6CC6)N=C5)=NN43)(F)F)=CC2=C1 |
| Synonyms | PLB-1001, PLB1001, PLB 1001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (186.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.56 mL | 117.82 mL | 235.64 mL |
| 0.5 mM | 4.71 mL | 23.56 mL | 47.13 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.56 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
