Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Debio-1347 is an orally bioavailable inhibitor of the fibroblast growth factor receptor subtypes 1 (FGFR-1), 2 (FGFR-2) and 3 (FGFR-3), with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14415 |
|---|---|
| Formula | C20H16N6O |
| Molecular Weight | 356.38 |
| CAS Number | 1265229-25-1 |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)N3C(=C(C=N3)C(=O)C4=CC5=CC=CC=C5N4)N |
| Synonyms | Debio 1347, Debio1347, CH5183284, CH 5183284, CH-5183284, FF-284, FF284, FF 284 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (196.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.06 mL | 140.3 mL | 280.6 mL |
| 0.5 mM | 5.61 mL | 28.06 mL | 56.12 mL |
| 1 mM | 2.81 mL | 14.03 mL | 28.06 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
