Desidustat (ZYAN1, ZYAN1-1001)
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Discription | Desidustat is an antianaemic drug candidate. It is an inhibitor of HIF hydroxylase extracted from patent WO 2014102818 A1, compound example 2. |
---|
Catalog Num | A16921 |
---|---|
Formula | C16H16N2O6 |
Molecular Weight | 332.31 |
CAS Number | 1616690-16-4 |
SMILES | O=C(O)CNC(C1=C(O)C2=C(N(OCC3CC3)C1=O)C=CC=C2)=O |
Storage | Store lyophilized at -20ºC, keep desiccated. |
In vitro | DMSO | 12 mg/mL (36.11 mM) | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 30.09 mL | 150.46 mL | 300.92 mL |
0.5 mM | 6.02 mL | 30.09 mL | 60.18 mL |
1 mM | 3.01 mL | 15.05 mL | 30.09 mL |
5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2