Total item
Cart Subtotal
$0.00 Biological Activity
Dovitinib is a small-molecule multitargeted receptor tyrosine kinase inhibitor, which inhibits Ba/F3 cells transformed to IL3 independence by ZNF198-FGFR1 or BCR-FGFR1 with IC50 values of 150 nM and 90 nM, respectively.
Targets
| Target | Value |
|---|---|
| FLT3 | IC50: 1nM |
| c-Kit | IC50: 2nM |
| FGFR1 | IC50: 8nM |
| VEGFR3/FLT4 | IC50: 8nM |
| FGFR3 | IC50: 9nM |
| VEGFR1/FLT1 | IC50: 10nM |
| VEGFR2/Flk1 | IC50: 13nM |
| PDGFRβ | IC50: 27nM |
| CSF-1R/c-Fms | IC50: 36nM |
| PDGFRα | IC50: 210nM |
| Insulin Receptor | IC50: 2μM |
| EGFR | IC50: 2μM |
| c-Met | IC50: >3μM |
| EphA2 | IC50: 4μM |
| Tie-2 | IC50: 4μM |
| IGF-1R | IC50: >10μM |
| HER2 | IC50: >10μM |
| In vitro (25°C) | DMSO | 90 mg/mL (157.18 mM) | |
| Water | 70 mg/mL (122.25 mM) | ||
| Ethanol | <1 mg/mL (<1 mM) | ||
| In vivo | Saline | 30 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.46 mL | 87.32 mL | 174.64 mL |
| 0.5 mM | 3.49 mL | 17.46 mL | 34.93 mL |
| 1 mM | 1.75 mL | 8.73 mL | 17.46 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.49 mL |
*The above data is based on the productmolecular weight 572.6. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A10198 |
|---|---|
| Actions | Inhibitor |
| M. Wt | 572.6 |
| Formula | C21H21FN6O.2C3H6O3 |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 852433-84-2 |
| Synonyms | CHIR-258, TKI258 |
| SMILES | CC(C(=O)O)O.CC(C(=O)O)O.CN1CCN(CC1)C2=CC3=C(C=C2)N/C(=C/4\C(=C5C(=NC4=O)C=CC=C5F)N)/N3 |
Datasheet
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy Dovitinib Dilactic acid (TKI258 Dilactic acid) | Dovitinib Dilactic acid (TKI258 Dilactic acid) Supplier | purchase Dovitinib Dilactic acid (TKI258 Dilactic acid) | Dovitinib Dilactic acid (TKI258 Dilactic acid) cost | Dovitinib Dilactic acid (TKI258 Dilactic acid) manufacturer | order Dovitinib Dilactic acid (TKI258 Dilactic acid) | Dovitinib Dilactic acid (TKI258 Dilactic acid) distributor | buy 852433-84-2| 852433-84-2 Supplier | purchase 852433-84-2 | 852433-84-2 cost | 852433-84-2 manufacturer | order 852433-84-2 | 852433-84-2 distributor
Adooq Quality Guarantee
We promise all products perform as described.