Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EMD-1214063 is an inhibitor of MET tyrosine kinase with potential antineoplastic activity. It binds to MET tyrosine kinase and disrupts MET signal transduction pathways, which may induce apoptosis in tumor cells overexpressing this kinase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11257 |
|---|---|
| Formula | C29H28N6O2 |
| Molecular Weight | 492.6 |
| CAS Number | 1100598-32-0 |
| SMILES | CN1CCC(CC1)COC2=CN=C(N=C2)C3=CC(=CC=C3)CN4C(=O)C=CC(=N4)C5=CC=CC(=C5)C#N |
| Synonyms | EMD1214063 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 4 mg/mL (8.12 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.3 mL | 101.5 mL | 203 mL |
| 0.5 mM | 4.06 mL | 20.3 mL | 40.6 mL |
| 1 mM | 2.03 mL | 10.15 mL | 20.3 mL |
| 5 mM | 0.41 mL | 2.03 mL | 4.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
