Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FF-10101 is a potent FLT3 inhibitor extracted from patent WO2015056683A1, compound example A. |
|---|
| Catalog Num | A20072 |
|---|---|
| Formula | C29H38N8O2 |
| Molecular Weight | 530.66 |
| CAS Number | 1472797-69-5 |
| SMILES | O=C(N([C@@H](C)C(NCCCC#CC1=CN=C(NC2=CC=C(C#N)C=C2)N=C1NCCC)=O)C)/C=C/CN(C)C |
| Synonyms | FF10101, FF 10101 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (184.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 98 mg/mL (184.67 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.84 mL | 94.22 mL | 188.44 mL |
| 0.5 mM | 3.77 mL | 18.84 mL | 37.69 mL |
| 1 mM | 1.88 mL | 9.42 mL | 18.84 mL |
| 5 mM | 0.38 mL | 1.88 mL | 3.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
