Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fisogatinib (BLU-554) is a potent, highly selective and orally active fibroblast growth factor receptor 4 (FGFR4) inhibitor with an IC50 of 5 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20354 |
|---|---|
| Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.38 |
| CAS Number | 1707289-21-1 |
| SMILES | C=CC(N[C@@H]1[C@H](NC2=NC=C3C=C(C4=C(Cl)C(OC)=CC(OC)=C4Cl)C=CC3=N2)COCC1)=O |
| Synonyms | BLU-554, BLU554, BLU 554 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 96 mg/mL (190.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (3.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.87 mL | 99.33 mL | 198.66 mL |
| 0.5 mM | 3.97 mL | 19.87 mL | 39.73 mL |
| 1 mM | 1.99 mL | 9.93 mL | 19.87 mL |
| 5 mM | 0.4 mL | 1.99 mL | 3.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
