Loading distributor info...
| Description | Furagin, nitrofurantoin analog, is an anti-bacterial agent. Furagin is 2-substituted 5-nitrofuran, chemically and structurally similar to well-known antibacterial compound nitrofurantoin. |
|---|
| Catalog Num | A18093 |
|---|---|
| Formula | C10H8N4O5 |
| Molecular Weight | 264.19 |
| CAS Number | 1672-88-4 |
| SMILES | O=C1NC(CN1/N=C/C=C\C2=CC=C([N+]([O-])=O)O2)=O |
| Synonyms | NF 416; NF416; NF-416; F-35; Akritoin; Furazidin; Furazidine; Furagin. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (177.9 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.85 mL | 189.26 mL | 378.52 mL |
| 0.5 mM | 7.57 mL | 37.85 mL | 75.7 mL |
| 1 mM | 3.79 mL | 18.93 mL | 37.85 mL |
| 5 mM | 0.76 mL | 3.79 mL | 7.57 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
