Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | G-749 is a novel and potent FLT3 inhibitor with IC50 of 0.4 nM, 0.6 nM and 1 nM for FLT3 (WT), FLT3 (D835Y). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14214 |
|---|---|
| Formula | C25H25BrN6O2 |
| Molecular Weight | 521.41 |
| CAS Number | 1457983-28-6 |
| SMILES | CN1CCC(CC1)NC2=NC3=C(C(=O)NC=C3Br)C(=N2)NC4=CC=C(C=C4)OC5=CC=CC=C5 |
| Synonyms | G749 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 22 mg/mL (42.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.18 mL | 95.89 mL | 191.79 mL |
| 0.5 mM | 3.84 mL | 19.18 mL | 38.36 mL |
| 1 mM | 1.92 mL | 9.59 mL | 19.18 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
