Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GNF 2 is a Bcr-abl inhibitor that inhibits proliferation and induces apoptosis in Bcr-abl-expressing cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11439 |
|---|---|
| Formula | C18H13F3N4O2 |
| Molecular Weight | 374.3 |
| CAS Number | 778270-11-4 |
| SMILES | C1=CC(=CC(=C1)C(=O)N)C2=CC(=NC=N2)NC3=CC=C(C=C3)OC(F)(F)F |
| Synonyms | GNF2,GNF-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (178.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.72 mL | 133.58 mL | 267.17 mL |
| 0.5 mM | 5.34 mL | 26.72 mL | 53.43 mL |
| 1 mM | 2.67 mL | 13.36 mL | 26.72 mL |
| 5 mM | 0.53 mL | 2.67 mL | 5.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
