Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GZD824 is a novel orally bioavailable Bcr-Abl inhibitor for Bcr-Abl(WT) and Bcr-Abl(T315I) with IC50 of 0.34 nM and 0.68 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15849 |
|---|---|
| Formula | C29H27F3N6O.2CH4O3S |
| Molecular Weight | 724.77 |
| CAS Number | 1421783-64-3 |
| SMILES | CC1=CC=C(C(NC2=CC=C(CN3CCN(C)CC3)C(C(F)(F)F)=C2)=O)C=C1C#CC4=CN=C5C(C=NN5)=C4.CS(=O)(O)=O.CS(=O)(O)=O |
| Synonyms | GZD-824 Dimesylate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (128.31 mM) | |
| Water | 93 mg/mL (128.31 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.8 mL | 68.99 mL | 137.97 mL |
| 0.5 mM | 2.76 mL | 13.8 mL | 27.59 mL |
| 1 mM | 1.38 mL | 6.9 mL | 13.8 mL |
| 5 mM | 0.28 mL | 1.38 mL | 2.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
