Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ibandronate sodium is a highly potent nitrogen-containing bisphosphonate used for the treatment of osteoporosis. |
|---|
| Catalog Num | A11870 |
|---|---|
| Formula | C9H22O7NP2Na.H2O |
| Molecular Weight | 359.2 |
| CAS Number | 138926-19-9 |
| SMILES | CCCCCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)[O-].O.[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 63 mg/mL (174.89 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.84 mL | 139.2 mL | 278.4 mL |
| 0.5 mM | 5.57 mL | 27.84 mL | 55.68 mL |
| 1 mM | 2.78 mL | 13.92 mL | 27.84 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
